C23H21N5S — CID 19146603
4-(2,2-diphenylhydrazinyl)-6-(4-methylphenyl)sulfanylpyrimidin-5-amine (PubChem CID 19146603) has the molecular formula C23H21N5S and a molecular weight of 399.52 g/mol. Its IUPAC name is 4-(2,2-diphenylhydrazinyl)-6-(4-methylphenyl)sulfanylpyrimidin-5-amine.
| Compound Name | 4-(2,2-diphenylhydrazinyl)-6-(4-methylphenyl)sulfanylpyrimidin-5-amine |
|---|---|
| PubChem CID | 19146603 |
| Molecular Formula | C23H21N5S |
| Molecular Weight | 399.52 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | 4-(2,2-diphenylhydrazinyl)-6-(4-methylphenyl)sulfanylpyrimidin-5-amine |
| SMILES | Cc1ccc(Sc2ncnc(NN(c3ccccc3)c3ccccc3)c2N)cc1 |
| InChI | InChI=1S/C23H21N5S/c1-17-12-14-20(15-13-17)29-23-21(24)22(25-16-26-23)27-28(18-8-4-2-5-9-18)19-10-6-3-7-11-19/h2-16H,24H2,1H3,(H,25,26,27) |
| InChIKey | XBQXNLRCAGHFLT-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.52 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|