C17H26N4O3 — CID 19154024
methyl 1-(5-amino-6-cyclohexyloxypyrimidin-4-yl)piperidine-4-carboxylate (PubChem CID 19154024) has the molecular formula C17H26N4O3 and a molecular weight of 334.42 g/mol. Its IUPAC name is methyl 1-(5-amino-6-cyclohexyloxypyrimidin-4-yl)piperidine-4-carboxylate.
| Compound Name | methyl 1-(5-amino-6-cyclohexyloxypyrimidin-4-yl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 19154024 |
| Molecular Formula | C17H26N4O3 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | methyl 1-(5-amino-6-cyclohexyloxypyrimidin-4-yl)piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(c2ncnc(OC3CCCCC3)c2N)CC1 |
| InChI | InChI=1S/C17H26N4O3/c1-23-17(22)12-7-9-21(10-8-12)15-14(18)16(20-11-19-15)24-13-5-3-2-4-6-13/h11-13H,2-10,18H2,1H3 |
| InChIKey | KCLYADHTFOVPEV-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 90.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |