C16H25N5O3 — CID 22543107
methyl 1-[5-amino-6-(oxolan-2-ylmethylamino)pyrimidin-4-yl]piperidine-4-carboxylate (PubChem CID 22543107) has the molecular formula C16H25N5O3 and a molecular weight of 335.41 g/mol. Its IUPAC name is methyl 1-[5-amino-6-(oxolan-2-ylmethylamino)pyrimidin-4-yl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[5-amino-6-(oxolan-2-ylmethylamino)pyrimidin-4-yl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 22543107 |
| Molecular Formula | C16H25N5O3 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | methyl 1-[5-amino-6-(oxolan-2-ylmethylamino)pyrimidin-4-yl]piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(c2ncnc(NCC3CCCO3)c2N)CC1 |
| InChI | InChI=1S/C16H25N5O3/c1-23-16(22)11-4-6-21(7-5-11)15-13(17)14(19-10-20-15)18-9-12-3-2-8-24-12/h10-12H,2-9,17H2,1H3,(H,18,19,20) |
| InChIKey | DETYYIVRZNOOBY-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 102.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |