C24H25N3O3S2 — CID 19164925
N-[4-(4-butoxyphenyl)-1,3-thiazol-2-yl]-2-(3-oxo-4H-1,4-benzothiazin-2-yl)propanamide (PubChem CID 19164925) has the molecular formula C24H25N3O3S2 and a molecular weight of 467.62 g/mol. Its IUPAC name is N-[4-(4-butoxyphenyl)-1,3-thiazol-2-yl]-2-(3-oxo-4H-1,4-benzothiazin-2-yl)propanamide.
| Compound Name | N-[4-(4-butoxyphenyl)-1,3-thiazol-2-yl]-2-(3-oxo-4H-1,4-benzothiazin-2-yl)propanamide |
|---|---|
| PubChem CID | 19164925 |
| Molecular Formula | C24H25N3O3S2 |
| Molecular Weight | 467.62 g/mol |
| Exact Mass | 467.13 |
| IUPAC Name | N-[4-(4-butoxyphenyl)-1,3-thiazol-2-yl]-2-(3-oxo-4H-1,4-benzothiazin-2-yl)propanamide |
| SMILES | CCCCOc1ccc(-c2csc(NC(=O)C(C)C3Sc4ccccc4NC3=O)n2)cc1 |
| InChI | InChI=1S/C24H25N3O3S2/c1-3-4-13-30-17-11-9-16(10-12-17)19-14-31-24(26-19)27-22(28)15(2)21-23(29)25-18-7-5-6-8-20(18)32-21/h5-12,14-15,21H,3-4,13H2,1-2H3,(H,25,29)(H,26,27,28) |
| InChIKey | AORCAJJVFGLUMK-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.62 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|