C26H24O8 — CID 19168458
(8,9,10-trimethoxy-6-oxobenzo[c]chromen-3-yl) 2-(4-ethylphenoxy)acetate (PubChem CID 19168458) has the molecular formula C26H24O8 and a molecular weight of 464.47 g/mol. Its IUPAC name is (8,9,10-trimethoxy-6-oxobenzo[c]chromen-3-yl) 2-(4-ethylphenoxy)acetate.
| Compound Name | (8,9,10-trimethoxy-6-oxobenzo[c]chromen-3-yl) 2-(4-ethylphenoxy)acetate |
|---|---|
| PubChem CID | 19168458 |
| Molecular Formula | C26H24O8 |
| Molecular Weight | 464.47 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | (8,9,10-trimethoxy-6-oxobenzo[c]chromen-3-yl) 2-(4-ethylphenoxy)acetate |
| SMILES | CCc1ccc(OCC(=O)Oc2ccc3c(c2)oc(=O)c2cc(OC)c(OC)c(OC)c23)cc1 |
| InChI | InChI=1S/C26H24O8/c1-5-15-6-8-16(9-7-15)32-14-22(27)33-17-10-11-18-20(12-17)34-26(28)19-13-21(29-2)24(30-3)25(31-4)23(18)19/h6-13H,5,14H2,1-4H3 |
| InChIKey | LWALMHGUCCDUEQ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 93.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.47 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|