C24H19NO10 — CID 23851709
(8,9,10-trimethoxy-6-oxobenzo[c]chromen-3-yl) 2-(2-nitrophenoxy)acetate (PubChem CID 23851709) has the molecular formula C24H19NO10 and a molecular weight of 481.41 g/mol. Its IUPAC name is (8,9,10-trimethoxy-6-oxobenzo[c]chromen-3-yl) 2-(2-nitrophenoxy)acetate.
| Compound Name | (8,9,10-trimethoxy-6-oxobenzo[c]chromen-3-yl) 2-(2-nitrophenoxy)acetate |
|---|---|
| PubChem CID | 23851709 |
| Molecular Formula | C24H19NO10 |
| Molecular Weight | 481.41 g/mol |
| Exact Mass | 481.10 |
| IUPAC Name | (8,9,10-trimethoxy-6-oxobenzo[c]chromen-3-yl) 2-(2-nitrophenoxy)acetate |
| SMILES | COc1cc2c(=O)oc3cc(OC(=O)COc4ccccc4[N+](=O)[O-])ccc3c2c(OC)c1OC |
| InChI | InChI=1S/C24H19NO10/c1-30-19-11-15-21(23(32-3)22(19)31-2)14-9-8-13(10-18(14)35-24(15)27)34-20(26)12-33-17-7-5-4-6-16(17)25(28)29/h4-11H,12H2,1-3H3 |
| InChIKey | YTNFDCSLJPAGCZ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 136.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.41 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|