C28H22O10 — CID 19168767
(8,9,10-trimethoxy-6-oxobenzo[c]chromen-3-yl) 2-(4-methyl-2-oxochromen-7-yl)oxyacetate (PubChem CID 19168767) has the molecular formula C28H22O10 and a molecular weight of 518.47 g/mol. Its IUPAC name is (8,9,10-trimethoxy-6-oxobenzo[c]chromen-3-yl) 2-(4-methyl-2-oxochromen-7-yl)oxyacetate.
| Compound Name | (8,9,10-trimethoxy-6-oxobenzo[c]chromen-3-yl) 2-(4-methyl-2-oxochromen-7-yl)oxyacetate |
|---|---|
| PubChem CID | 19168767 |
| Molecular Formula | C28H22O10 |
| Molecular Weight | 518.47 g/mol |
| Exact Mass | 518.12 |
| IUPAC Name | (8,9,10-trimethoxy-6-oxobenzo[c]chromen-3-yl) 2-(4-methyl-2-oxochromen-7-yl)oxyacetate |
| SMILES | COc1cc2c(=O)oc3cc(OC(=O)COc4ccc5c(C)cc(=O)oc5c4)ccc3c2c(OC)c1OC |
| InChI | InChI=1S/C28H22O10/c1-14-9-23(29)37-20-10-15(5-7-17(14)20)35-13-24(30)36-16-6-8-18-21(11-16)38-28(31)19-12-22(32-2)26(33-3)27(34-4)25(18)19/h5-12H,13H2,1-4H3 |
| InChIKey | YGIIWYNJWVTEKX-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 123.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.47 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|