C29H25ClO4 — CID 19171250
[2-methoxy-4-[(E)-2-naphthalen-1-ylethenyl]phenyl] 2-(4-chloro-3,5-dimethylphenoxy)acetate (PubChem CID 19171250) has the molecular formula C29H25ClO4 and a molecular weight of 472.97 g/mol. Its IUPAC name is [2-methoxy-4-[(E)-2-naphthalen-1-ylethenyl]phenyl] 2-(4-chloro-3,5-dimethylphenoxy)acetate.
| Compound Name | [2-methoxy-4-[(E)-2-naphthalen-1-ylethenyl]phenyl] 2-(4-chloro-3,5-dimethylphenoxy)acetate |
|---|---|
| PubChem CID | 19171250 |
| Molecular Formula | C29H25ClO4 |
| Molecular Weight | 472.97 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | [2-methoxy-4-[(E)-2-naphthalen-1-ylethenyl]phenyl] 2-(4-chloro-3,5-dimethylphenoxy)acetate |
| SMILES | COc1cc(/C=C/c2cccc3ccccc23)ccc1OC(=O)COc1cc(C)c(Cl)c(C)c1 |
| InChI | InChI=1S/C29H25ClO4/c1-19-15-24(16-20(2)29(19)30)33-18-28(31)34-26-14-12-21(17-27(26)32-3)11-13-23-9-6-8-22-7-4-5-10-25(22)23/h4-17H,18H2,1-3H3/b13-11+ |
| InChIKey | IUNPHCHKWKMSSS-ACCUITESSA-N |
| XLogP | 7.27 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.97 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|