C26H29N3O3S — CID 19177014
(E)-N-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)-3-[3-methoxy-4-[(2-methylphenyl)methoxy]phenyl]prop-2-enamide (PubChem CID 19177014) has the molecular formula C26H29N3O3S and a molecular weight of 463.60 g/mol. Its IUPAC name is (E)-N-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)-3-[3-methoxy-4-[(2-methylphenyl)methoxy]phenyl]prop-2-enamide.
| Compound Name | (E)-N-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)-3-[3-methoxy-4-[(2-methylphenyl)methoxy]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 19177014 |
| Molecular Formula | C26H29N3O3S |
| Molecular Weight | 463.60 g/mol |
| Exact Mass | 463.19 |
| IUPAC Name | (E)-N-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)-3-[3-methoxy-4-[(2-methylphenyl)methoxy]phenyl]prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)Nc2nnc(C3CCCCC3)s2)ccc1OCc1ccccc1C |
| InChI | InChI=1S/C26H29N3O3S/c1-18-8-6-7-11-21(18)17-32-22-14-12-19(16-23(22)31-2)13-15-24(30)27-26-29-28-25(33-26)20-9-4-3-5-10-20/h6-8,11-16,20H,3-5,9-10,17H2,1-2H3,(H,27,29,30)/b15-13+ |
| InChIKey | RRGRXRXYYYCXPM-FYWRMAATSA-N |
| XLogP | 6.13 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.60 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|