C27H26N2O3S — CID 19227067
(E)-N-(4,6-dimethyl-1,3-benzothiazol-2-yl)-3-[3-methoxy-4-[(2-methylphenyl)methoxy]phenyl]prop-2-enamide (PubChem CID 19227067) has the molecular formula C27H26N2O3S and a molecular weight of 458.58 g/mol. Its IUPAC name is (E)-N-(4,6-dimethyl-1,3-benzothiazol-2-yl)-3-[3-methoxy-4-[(2-methylphenyl)methoxy]phenyl]prop-2-enamide.
| Compound Name | (E)-N-(4,6-dimethyl-1,3-benzothiazol-2-yl)-3-[3-methoxy-4-[(2-methylphenyl)methoxy]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 19227067 |
| Molecular Formula | C27H26N2O3S |
| Molecular Weight | 458.58 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | (E)-N-(4,6-dimethyl-1,3-benzothiazol-2-yl)-3-[3-methoxy-4-[(2-methylphenyl)methoxy]phenyl]prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)Nc2nc3c(C)cc(C)cc3s2)ccc1OCc1ccccc1C |
| InChI | InChI=1S/C27H26N2O3S/c1-17-13-19(3)26-24(14-17)33-27(29-26)28-25(30)12-10-20-9-11-22(23(15-20)31-4)32-16-21-8-6-5-7-18(21)2/h5-15H,16H2,1-4H3,(H,28,29,30)/b12-10+ |
| InChIKey | LOAYQXCMLMHDOO-ZRDIBKRKSA-N |
| XLogP | 6.46 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.58 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|