C24H30N2O4S2 — CID 19188733
methyl 2-[4-(4-tert-butylphenoxy)butanoylcarbamothioylamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate (PubChem CID 19188733) has the molecular formula C24H30N2O4S2 and a molecular weight of 474.65 g/mol. Its IUPAC name is methyl 2-[4-(4-tert-butylphenoxy)butanoylcarbamothioylamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate.
| Compound Name | methyl 2-[4-(4-tert-butylphenoxy)butanoylcarbamothioylamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19188733 |
| Molecular Formula | C24H30N2O4S2 |
| Molecular Weight | 474.65 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | methyl 2-[4-(4-tert-butylphenoxy)butanoylcarbamothioylamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=S)NC(=O)CCCOc2ccc(C(C)(C)C)cc2)sc2c1CCC2 |
| InChI | InChI=1S/C24H30N2O4S2/c1-24(2,3)15-10-12-16(13-11-15)30-14-6-9-19(27)25-23(31)26-21-20(22(28)29-4)17-7-5-8-18(17)32-21/h10-13H,5-9,14H2,1-4H3,(H2,25,26,27,31) |
| InChIKey | MRFPUXKFJBNJOI-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.65 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|