C7H11N3 — CID 19194
2,4-diethyl-1,3,5-triazine (PubChem CID 19194) has the molecular formula C7H11N3 and a molecular weight of 137.19 g/mol. Its IUPAC name is 2,4-diethyl-1,3,5-triazine.
| Compound Name | 2,4-diethyl-1,3,5-triazine |
|---|---|
| PubChem CID | 19194 |
| Molecular Formula | C7H11N3 |
| Molecular Weight | 137.19 g/mol |
| Exact Mass | 137.10 |
| IUPAC Name | 2,4-diethyl-1,3,5-triazine |
| SMILES | CCc1ncnc(CC)n1 |
| InChI | InChI=1S/C7H11N3/c1-3-6-8-5-9-7(4-2)10-6/h5H,3-4H2,1-2H3 |
| InChIKey | LFMSWHCONRLNAR-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.19 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |