C26H23ClN4O3S2 — CID 19204961
N-[[4-[(2-chlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-2-[(5-phenyl-1,3,4-thiadiazol-2-yl)sulfanyl]acetamide (PubChem CID 19204961) has the molecular formula C26H23ClN4O3S2 and a molecular weight of 539.08 g/mol. Its IUPAC name is N-[[4-[(2-chlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-2-[(5-phenyl-1,3,4-thiadiazol-2-yl)sulfanyl]acetamide.
| Compound Name | N-[[4-[(2-chlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-2-[(5-phenyl-1,3,4-thiadiazol-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 19204961 |
| Molecular Formula | C26H23ClN4O3S2 |
| Molecular Weight | 539.08 g/mol |
| Exact Mass | 538.09 |
| IUPAC Name | N-[[4-[(2-chlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-2-[(5-phenyl-1,3,4-thiadiazol-2-yl)sulfanyl]acetamide |
| SMILES | CCOc1cc(C=NNC(=O)CSc2nnc(-c3ccccc3)s2)ccc1OCc1ccccc1Cl |
| InChI | InChI=1S/C26H23ClN4O3S2/c1-2-33-23-14-18(12-13-22(23)34-16-20-10-6-7-11-21(20)27)15-28-29-24(32)17-35-26-31-30-25(36-26)19-8-4-3-5-9-19/h3-15H,2,16-17H2,1H3,(H,29,32) |
| InChIKey | FABQWAJVEGEBQN-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 85.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.08 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|