C24H17BrCl2N4O2S2 — CID 19205022
N-[[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-2-[(5-phenyl-1,3,4-thiadiazol-2-yl)sulfanyl]acetamide (PubChem CID 19205022) has the molecular formula C24H17BrCl2N4O2S2 and a molecular weight of 608.37 g/mol. Its IUPAC name is N-[[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-2-[(5-phenyl-1,3,4-thiadiazol-2-yl)sulfanyl]acetamide.
| Compound Name | N-[[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-2-[(5-phenyl-1,3,4-thiadiazol-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 19205022 |
| Molecular Formula | C24H17BrCl2N4O2S2 |
| Molecular Weight | 608.37 g/mol |
| Exact Mass | 605.94 |
| IUPAC Name | N-[[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-2-[(5-phenyl-1,3,4-thiadiazol-2-yl)sulfanyl]acetamide |
| SMILES | O=C(CSc1nnc(-c2ccccc2)s1)NN=Cc1cc(Br)ccc1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C24H17BrCl2N4O2S2/c25-18-7-9-21(33-13-16-6-8-19(26)11-20(16)27)17(10-18)12-28-29-22(32)14-34-24-31-30-23(35-24)15-4-2-1-3-5-15/h1-12H,13-14H2,(H,29,32) |
| InChIKey | JVJCQMIAEADPHR-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 76.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.37 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|