C22H21NO4S — CID 19217816
N-(benzenesulfonyl)-2-(2,6-dimethylphenoxy)-N-phenylacetamide (PubChem CID 19217816) has the molecular formula C22H21NO4S and a molecular weight of 395.48 g/mol. Its IUPAC name is N-(benzenesulfonyl)-2-(2,6-dimethylphenoxy)-N-phenylacetamide.
| Compound Name | N-(benzenesulfonyl)-2-(2,6-dimethylphenoxy)-N-phenylacetamide |
|---|---|
| PubChem CID | 19217816 |
| Molecular Formula | C22H21NO4S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | N-(benzenesulfonyl)-2-(2,6-dimethylphenoxy)-N-phenylacetamide |
| SMILES | Cc1cccc(C)c1OCC(=O)N(c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C22H21NO4S/c1-17-10-9-11-18(2)22(17)27-16-21(24)23(19-12-5-3-6-13-19)28(25,26)20-14-7-4-8-15-20/h3-15H,16H2,1-2H3 |
| InChIKey | GPAHZRJKDZMBDY-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |