C24H23N3O2S2 — CID 19229142
(E)-2-cyano-N-(4-cyano-7-methyl-1-sulfanylidene-5,6,7,8-tetrahydroisothiochromen-3-yl)-3-(2-propoxyphenyl)prop-2-enamide (PubChem CID 19229142) has the molecular formula C24H23N3O2S2 and a molecular weight of 449.60 g/mol. Its IUPAC name is (E)-2-cyano-N-(4-cyano-7-methyl-1-sulfanylidene-5,6,7,8-tetrahydroisothiochromen-3-yl)-3-(2-propoxyphenyl)prop-2-enamide.
| Compound Name | (E)-2-cyano-N-(4-cyano-7-methyl-1-sulfanylidene-5,6,7,8-tetrahydroisothiochromen-3-yl)-3-(2-propoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 19229142 |
| Molecular Formula | C24H23N3O2S2 |
| Molecular Weight | 449.60 g/mol |
| Exact Mass | 449.12 |
| IUPAC Name | (E)-2-cyano-N-(4-cyano-7-methyl-1-sulfanylidene-5,6,7,8-tetrahydroisothiochromen-3-yl)-3-(2-propoxyphenyl)prop-2-enamide |
| SMILES | CCCOc1ccccc1/C=C(\C#N)C(=O)Nc1sc(=S)c2c(c1C#N)CCC(C)C2 |
| InChI | InChI=1S/C24H23N3O2S2/c1-3-10-29-21-7-5-4-6-16(21)12-17(13-25)22(28)27-23-20(14-26)18-9-8-15(2)11-19(18)24(30)31-23/h4-7,12,15H,3,8-11H2,1-2H3,(H,27,28)/b17-12+ |
| InChIKey | WCIUXIAYIGCWCA-SFQUDFHCSA-N |
| XLogP | 5.81 |
| TPSA | 85.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.60 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_ester_A(5)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|