C21H27N3O4S — CID 19236843
(E)-3-(4-butoxy-3-ethoxyphenyl)-N-[5-(oxolan-2-yl)-1,3,4-thiadiazol-2-yl]prop-2-enamide (PubChem CID 19236843) has the molecular formula C21H27N3O4S and a molecular weight of 417.53 g/mol. Its IUPAC name is (E)-3-(4-butoxy-3-ethoxyphenyl)-N-[5-(oxolan-2-yl)-1,3,4-thiadiazol-2-yl]prop-2-enamide.
| Compound Name | (E)-3-(4-butoxy-3-ethoxyphenyl)-N-[5-(oxolan-2-yl)-1,3,4-thiadiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 19236843 |
| Molecular Formula | C21H27N3O4S |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | (E)-3-(4-butoxy-3-ethoxyphenyl)-N-[5-(oxolan-2-yl)-1,3,4-thiadiazol-2-yl]prop-2-enamide |
| SMILES | CCCCOc1ccc(/C=C/C(=O)Nc2nnc(C3CCCO3)s2)cc1OCC |
| InChI | InChI=1S/C21H27N3O4S/c1-3-5-12-27-16-10-8-15(14-18(16)26-4-2)9-11-19(25)22-21-24-23-20(29-21)17-7-6-13-28-17/h8-11,14,17H,3-7,12-13H2,1-2H3,(H,22,24,25)/b11-9+ |
| InChIKey | VEMMOTZCKLEGDF-PKNBQFBNSA-N |
| XLogP | 4.62 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|