C22H22ClNO5 — CID 19241249
ethyl 5-chloro-4-[(5-ethyl-3-methyl-1-benzofuran-2-carbonyl)amino]-2-methoxybenzoate (PubChem CID 19241249) has the molecular formula C22H22ClNO5 and a molecular weight of 415.87 g/mol. Its IUPAC name is ethyl 5-chloro-4-[(5-ethyl-3-methyl-1-benzofuran-2-carbonyl)amino]-2-methoxybenzoate.
| Compound Name | ethyl 5-chloro-4-[(5-ethyl-3-methyl-1-benzofuran-2-carbonyl)amino]-2-methoxybenzoate |
|---|---|
| PubChem CID | 19241249 |
| Molecular Formula | C22H22ClNO5 |
| Molecular Weight | 415.87 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | ethyl 5-chloro-4-[(5-ethyl-3-methyl-1-benzofuran-2-carbonyl)amino]-2-methoxybenzoate |
| SMILES | CCOC(=O)c1cc(Cl)c(NC(=O)c2oc3ccc(CC)cc3c2C)cc1OC |
| InChI | InChI=1S/C22H22ClNO5/c1-5-13-7-8-18-14(9-13)12(3)20(29-18)21(25)24-17-11-19(27-4)15(10-16(17)23)22(26)28-6-2/h7-11H,5-6H2,1-4H3,(H,24,25) |
| InChIKey | XISXJYIHUQJEQC-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.87 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |