C25H19NO5 — CID 19245179
3-[[2-(4-ethoxybenzoyl)-1-benzofuran-3-yl]amino]-3H-2-benzofuran-1-one (PubChem CID 19245179) has the molecular formula C25H19NO5 and a molecular weight of 413.43 g/mol. Its IUPAC name is 3-[[2-(4-ethoxybenzoyl)-1-benzofuran-3-yl]amino]-3H-2-benzofuran-1-one.
| Compound Name | 3-[[2-(4-ethoxybenzoyl)-1-benzofuran-3-yl]amino]-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 19245179 |
| Molecular Formula | C25H19NO5 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | 3-[[2-(4-ethoxybenzoyl)-1-benzofuran-3-yl]amino]-3H-2-benzofuran-1-one |
| SMILES | CCOc1ccc(C(=O)c2oc3ccccc3c2NC2OC(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C25H19NO5/c1-2-29-16-13-11-15(12-14-16)22(27)23-21(19-9-5-6-10-20(19)30-23)26-24-17-7-3-4-8-18(17)25(28)31-24/h3-14,24,26H,2H2,1H3 |
| InChIKey | PRTDSTWZMPRMQD-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |