C20H19N5O8 — CID 19274142
N-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]-1-[(2-nitrophenoxy)methyl]pyrazole-3-carboxamide (PubChem CID 19274142) has the molecular formula C20H19N5O8 and a molecular weight of 457.40 g/mol. Its IUPAC name is N-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]-1-[(2-nitrophenoxy)methyl]pyrazole-3-carboxamide.
| Compound Name | N-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]-1-[(2-nitrophenoxy)methyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19274142 |
| Molecular Formula | C20H19N5O8 |
| Molecular Weight | 457.40 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | N-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]-1-[(2-nitrophenoxy)methyl]pyrazole-3-carboxamide |
| SMILES | O=C(NC(CO)C(O)c1ccc([N+](=O)[O-])cc1)c1ccn(COc2ccccc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C20H19N5O8/c26-11-16(19(27)13-5-7-14(8-6-13)24(29)30)21-20(28)15-9-10-23(22-15)12-33-18-4-2-1-3-17(18)25(31)32/h1-10,16,19,26-27H,11-12H2,(H,21,28) |
| InChIKey | OVBVKIQXVOIAMP-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 182.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.40 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|