C20H19ClN4O6 — CID 19280349
1-[(4-chlorophenoxy)methyl]-N-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]pyrazole-3-carboxamide (PubChem CID 19280349) has the molecular formula C20H19ClN4O6 and a molecular weight of 446.85 g/mol. Its IUPAC name is 1-[(4-chlorophenoxy)methyl]-N-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]pyrazole-3-carboxamide.
| Compound Name | 1-[(4-chlorophenoxy)methyl]-N-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19280349 |
| Molecular Formula | C20H19ClN4O6 |
| Molecular Weight | 446.85 g/mol |
| Exact Mass | 446.10 |
| IUPAC Name | 1-[(4-chlorophenoxy)methyl]-N-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]pyrazole-3-carboxamide |
| SMILES | O=C(NC(CO)C(O)c1ccc([N+](=O)[O-])cc1)c1ccn(COc2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C20H19ClN4O6/c21-14-3-7-16(8-4-14)31-12-24-10-9-17(23-24)20(28)22-18(11-26)19(27)13-1-5-15(6-2-13)25(29)30/h1-10,18-19,26-27H,11-12H2,(H,22,28) |
| InChIKey | POXTXOYQOVQOMT-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 139.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.85 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|