C24H26N2O7 — CID 19448236
N-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]-5-[(4-propan-2-ylphenoxy)methyl]furan-2-carboxamide (PubChem CID 19448236) has the molecular formula C24H26N2O7 and a molecular weight of 454.48 g/mol. Its IUPAC name is N-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]-5-[(4-propan-2-ylphenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]-5-[(4-propan-2-ylphenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19448236 |
| Molecular Formula | C24H26N2O7 |
| Molecular Weight | 454.48 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | N-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]-5-[(4-propan-2-ylphenoxy)methyl]furan-2-carboxamide |
| SMILES | CC(C)c1ccc(OCc2ccc(C(=O)NC(CO)C(O)c3ccc([N+](=O)[O-])cc3)o2)cc1 |
| InChI | InChI=1S/C24H26N2O7/c1-15(2)16-5-9-19(10-6-16)32-14-20-11-12-22(33-20)24(29)25-21(13-27)23(28)17-3-7-18(8-4-17)26(30)31/h3-12,15,21,23,27-28H,13-14H2,1-2H3,(H,25,29) |
| InChIKey | OXPSVMIBOWTJRA-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 135.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.48 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|