C21H19FN2O7 — CID 19413168
N-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]-5-[(4-fluorophenoxy)methyl]furan-2-carboxamide (PubChem CID 19413168) has the molecular formula C21H19FN2O7 and a molecular weight of 430.39 g/mol. Its IUPAC name is N-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]-5-[(4-fluorophenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]-5-[(4-fluorophenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19413168 |
| Molecular Formula | C21H19FN2O7 |
| Molecular Weight | 430.39 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | N-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]-5-[(4-fluorophenoxy)methyl]furan-2-carboxamide |
| SMILES | O=C(NC(CO)C(O)c1ccc([N+](=O)[O-])cc1)c1ccc(COc2ccc(F)cc2)o1 |
| InChI | InChI=1S/C21H19FN2O7/c22-14-3-7-16(8-4-14)30-12-17-9-10-19(31-17)21(27)23-18(11-25)20(26)13-1-5-15(6-2-13)24(28)29/h1-10,18,20,25-26H,11-12H2,(H,23,27) |
| InChIKey | DIJAOVDAPVCKMQ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 135.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.39 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|