C33H28ClF3N4O3S — CID 19308575
N-[(E)-3-[3-[2-[2-chloro-5-(trifluoromethyl)anilino]-2-oxoethyl]sulfanylanilino]-1-[4-(dimethylamino)phenyl]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19308575) has the molecular formula C33H28ClF3N4O3S and a molecular weight of 653.13 g/mol. Its IUPAC name is N-[(E)-3-[3-[2-[2-chloro-5-(trifluoromethyl)anilino]-2-oxoethyl]sulfanylanilino]-1-[4-(dimethylamino)phenyl]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-[3-[2-[2-chloro-5-(trifluoromethyl)anilino]-2-oxoethyl]sulfanylanilino]-1-[4-(dimethylamino)phenyl]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19308575 |
| Molecular Formula | C33H28ClF3N4O3S |
| Molecular Weight | 653.13 g/mol |
| Exact Mass | 652.15 |
| IUPAC Name | N-[(E)-3-[3-[2-[2-chloro-5-(trifluoromethyl)anilino]-2-oxoethyl]sulfanylanilino]-1-[4-(dimethylamino)phenyl]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CN(C)c1ccc(/C=C(/NC(=O)c2ccccc2)C(=O)Nc2cccc(SCC(=O)Nc3cc(C(F)(F)F)ccc3Cl)c2)cc1 |
| InChI | InChI=1S/C33H28ClF3N4O3S/c1-41(2)25-14-11-21(12-15-25)17-29(40-31(43)22-7-4-3-5-8-22)32(44)38-24-9-6-10-26(19-24)45-20-30(42)39-28-18-23(33(35,36)37)13-16-27(28)34/h3-19H,20H2,1-2H3,(H,38,44)(H,39,42)(H,40,43)/b29-17+ |
| InChIKey | NMPGCIVNIXEJMD-STBIYBPSSA-N |
| XLogP | 7.57 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.13 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|