C19H25N5O4 — CID 19323295
1-[4-[(3-methoxyphenyl)methyl]piperazin-1-yl]-2-(4-nitropyrazol-1-yl)butan-1-one (PubChem CID 19323295) has the molecular formula C19H25N5O4 and a molecular weight of 387.44 g/mol. Its IUPAC name is 1-[4-[(3-methoxyphenyl)methyl]piperazin-1-yl]-2-(4-nitropyrazol-1-yl)butan-1-one.
| Compound Name | 1-[4-[(3-methoxyphenyl)methyl]piperazin-1-yl]-2-(4-nitropyrazol-1-yl)butan-1-one |
|---|---|
| PubChem CID | 19323295 |
| Molecular Formula | C19H25N5O4 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | 1-[4-[(3-methoxyphenyl)methyl]piperazin-1-yl]-2-(4-nitropyrazol-1-yl)butan-1-one |
| SMILES | CCC(C(=O)N1CCN(Cc2cccc(OC)c2)CC1)n1cc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C19H25N5O4/c1-3-18(23-14-16(12-20-23)24(26)27)19(25)22-9-7-21(8-10-22)13-15-5-4-6-17(11-15)28-2/h4-6,11-12,14,18H,3,7-10,13H2,1-2H3 |
| InChIKey | JUUGOVDJHMNZTF-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 93.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|