C11H20N4OS — CID 19324710
1-[(1,5-dimethylpyrazol-4-yl)methyl]-3-(3-methoxypropyl)thiourea (PubChem CID 19324710) has the molecular formula C11H20N4OS and a molecular weight of 256.37 g/mol. Its IUPAC name is 1-[(1,5-dimethylpyrazol-4-yl)methyl]-3-(3-methoxypropyl)thiourea.
| Compound Name | 1-[(1,5-dimethylpyrazol-4-yl)methyl]-3-(3-methoxypropyl)thiourea |
|---|---|
| PubChem CID | 19324710 |
| Molecular Formula | C11H20N4OS |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | 1-[(1,5-dimethylpyrazol-4-yl)methyl]-3-(3-methoxypropyl)thiourea |
| SMILES | COCCCNC(=S)NCc1cnn(C)c1C |
| InChI | InChI=1S/C11H20N4OS/c1-9-10(8-14-15(9)2)7-13-11(17)12-5-4-6-16-3/h8H,4-7H2,1-3H3,(H2,12,13,17) |
| InChIKey | DGPLMEAEOGNVAV-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 51.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|