C21H17Cl2N3O3 — CID 19326552
2-[5-[3-(2,4-dichlorophenyl)-1,2,4-oxadiazol-5-yl]pentyl]isoindole-1,3-dione (PubChem CID 19326552) has the molecular formula C21H17Cl2N3O3 and a molecular weight of 430.29 g/mol. Its IUPAC name is 2-[5-[3-(2,4-dichlorophenyl)-1,2,4-oxadiazol-5-yl]pentyl]isoindole-1,3-dione.
| Compound Name | 2-[5-[3-(2,4-dichlorophenyl)-1,2,4-oxadiazol-5-yl]pentyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 19326552 |
| Molecular Formula | C21H17Cl2N3O3 |
| Molecular Weight | 430.29 g/mol |
| Exact Mass | 429.06 |
| IUPAC Name | 2-[5-[3-(2,4-dichlorophenyl)-1,2,4-oxadiazol-5-yl]pentyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCCCCc1nc(-c2ccc(Cl)cc2Cl)no1 |
| InChI | InChI=1S/C21H17Cl2N3O3/c22-13-9-10-16(17(23)12-13)19-24-18(29-25-19)8-2-1-5-11-26-20(27)14-6-3-4-7-15(14)21(26)28/h3-4,6-7,9-10,12H,1-2,5,8,11H2 |
| InChIKey | BFNONEMXQBFYJE-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 76.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.29 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|