C19H14N4O5 — CID 32706022
5-nitro-2-[3-(3-phenyl-1,2,4-oxadiazol-5-yl)propyl]isoindole-1,3-dione (PubChem CID 32706022) has the molecular formula C19H14N4O5 and a molecular weight of 378.34 g/mol. Its IUPAC name is 5-nitro-2-[3-(3-phenyl-1,2,4-oxadiazol-5-yl)propyl]isoindole-1,3-dione.
| Compound Name | 5-nitro-2-[3-(3-phenyl-1,2,4-oxadiazol-5-yl)propyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 32706022 |
| Molecular Formula | C19H14N4O5 |
| Molecular Weight | 378.34 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | 5-nitro-2-[3-(3-phenyl-1,2,4-oxadiazol-5-yl)propyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccc([N+](=O)[O-])cc2C(=O)N1CCCc1nc(-c2ccccc2)no1 |
| InChI | InChI=1S/C19H14N4O5/c24-18-14-9-8-13(23(26)27)11-15(14)19(25)22(18)10-4-7-16-20-17(21-28-16)12-5-2-1-3-6-12/h1-3,5-6,8-9,11H,4,7,10H2 |
| InChIKey | PUUFCUIAVRGMLP-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 119.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.34 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|