C19H15Cl2N5O2 — CID 19330653
3-[5-[1-[(2,4-dichlorophenoxy)methyl]pyrazol-3-yl]-1,2,4-oxadiazol-3-yl]-2-methylaniline (PubChem CID 19330653) has the molecular formula C19H15Cl2N5O2 and a molecular weight of 416.27 g/mol. Its IUPAC name is 3-[5-[1-[(2,4-dichlorophenoxy)methyl]pyrazol-3-yl]-1,2,4-oxadiazol-3-yl]-2-methylaniline.
| Compound Name | 3-[5-[1-[(2,4-dichlorophenoxy)methyl]pyrazol-3-yl]-1,2,4-oxadiazol-3-yl]-2-methylaniline |
|---|---|
| PubChem CID | 19330653 |
| Molecular Formula | C19H15Cl2N5O2 |
| Molecular Weight | 416.27 g/mol |
| Exact Mass | 415.06 |
| IUPAC Name | 3-[5-[1-[(2,4-dichlorophenoxy)methyl]pyrazol-3-yl]-1,2,4-oxadiazol-3-yl]-2-methylaniline |
| SMILES | Cc1c(N)cccc1-c1noc(-c2ccn(COc3ccc(Cl)cc3Cl)n2)n1 |
| InChI | InChI=1S/C19H15Cl2N5O2/c1-11-13(3-2-4-15(11)22)18-23-19(28-25-18)16-7-8-26(24-16)10-27-17-6-5-12(20)9-14(17)21/h2-9H,10,22H2,1H3 |
| InChIKey | MYTLBUAMAOSALY-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 91.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.27 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|