C20H17F5N4OS — CID 19343363
1-[3,5-dimethyl-1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-4-yl]-3-(2-methoxyphenyl)thiourea (PubChem CID 19343363) has the molecular formula C20H17F5N4OS and a molecular weight of 456.44 g/mol. Its IUPAC name is 1-[3,5-dimethyl-1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-4-yl]-3-(2-methoxyphenyl)thiourea.
| Compound Name | 1-[3,5-dimethyl-1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-4-yl]-3-(2-methoxyphenyl)thiourea |
|---|---|
| PubChem CID | 19343363 |
| Molecular Formula | C20H17F5N4OS |
| Molecular Weight | 456.44 g/mol |
| Exact Mass | 456.10 |
| IUPAC Name | 1-[3,5-dimethyl-1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-4-yl]-3-(2-methoxyphenyl)thiourea |
| SMILES | COc1ccccc1NC(=S)Nc1c(C)nn(Cc2c(F)c(F)c(F)c(F)c2F)c1C |
| InChI | InChI=1S/C20H17F5N4OS/c1-9-19(27-20(31)26-12-6-4-5-7-13(12)30-3)10(2)29(28-9)8-11-14(21)16(23)18(25)17(24)15(11)22/h4-7H,8H2,1-3H3,(H2,26,27,31) |
| InChIKey | KEOHAUWOSWLILZ-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 51.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.44 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|