C19H13F7N4S — CID 17374611
1-(2,4-difluorophenyl)-3-[3,5-dimethyl-1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-4-yl]thiourea (PubChem CID 17374611) has the molecular formula C19H13F7N4S and a molecular weight of 462.39 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-[3,5-dimethyl-1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-4-yl]thiourea.
| Compound Name | 1-(2,4-difluorophenyl)-3-[3,5-dimethyl-1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-4-yl]thiourea |
|---|---|
| PubChem CID | 17374611 |
| Molecular Formula | C19H13F7N4S |
| Molecular Weight | 462.39 g/mol |
| Exact Mass | 462.07 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-[3,5-dimethyl-1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-4-yl]thiourea |
| SMILES | Cc1nn(Cc2c(F)c(F)c(F)c(F)c2F)c(C)c1NC(=S)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C19H13F7N4S/c1-7-18(28-19(31)27-12-4-3-9(20)5-11(12)21)8(2)30(29-7)6-10-13(22)15(24)17(26)16(25)14(10)23/h3-5H,6H2,1-2H3,(H2,27,28,31) |
| InChIKey | XHIRHHGVZWNHFQ-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.39 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|