C19H27NO2S — CID 19360973
ethyl 2-(5,7-ditert-butyl-1,3-benzothiazol-2-yl)acetate (PubChem CID 19360973) has the molecular formula C19H27NO2S and a molecular weight of 333.50 g/mol. Its IUPAC name is ethyl 2-(5,7-ditert-butyl-1,3-benzothiazol-2-yl)acetate.
| Compound Name | ethyl 2-(5,7-ditert-butyl-1,3-benzothiazol-2-yl)acetate |
|---|---|
| PubChem CID | 19360973 |
| Molecular Formula | C19H27NO2S |
| Molecular Weight | 333.50 g/mol |
| Exact Mass | 333.18 |
| IUPAC Name | ethyl 2-(5,7-ditert-butyl-1,3-benzothiazol-2-yl)acetate |
| SMILES | CCOC(=O)Cc1nc2cc(C(C)(C)C)cc(C(C)(C)C)c2s1 |
| InChI | InChI=1S/C19H27NO2S/c1-8-22-16(21)11-15-20-14-10-12(18(2,3)4)9-13(17(14)23-15)19(5,6)7/h9-10H,8,11H2,1-7H3 |
| InChIKey | SFQYVRAXNPSITO-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.50 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |