C19H19N5 — CID 19361591
N-[3-[6-(1,2,4-triazol-4-yl)indol-1-yl]propyl]aniline (PubChem CID 19361591) has the molecular formula C19H19N5 and a molecular weight of 317.40 g/mol. Its IUPAC name is N-[3-[6-(1,2,4-triazol-4-yl)indol-1-yl]propyl]aniline.
| Compound Name | N-[3-[6-(1,2,4-triazol-4-yl)indol-1-yl]propyl]aniline |
|---|---|
| PubChem CID | 19361591 |
| Molecular Formula | C19H19N5 |
| Molecular Weight | 317.40 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | N-[3-[6-(1,2,4-triazol-4-yl)indol-1-yl]propyl]aniline |
| SMILES | c1ccc(NCCCn2ccc3ccc(-n4cnnc4)cc32)cc1 |
| InChI | InChI=1S/C19H19N5/c1-2-5-17(6-3-1)20-10-4-11-23-12-9-16-7-8-18(13-19(16)23)24-14-21-22-15-24/h1-3,5-9,12-15,20H,4,10-11H2 |
| InChIKey | QAOSRUPMRWEFIV-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 47.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.40 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|