C48H72NO8P — CID 19366427
2,3-bis[[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]oxy]propyl 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 19366427) has the molecular formula C48H72NO8P and a molecular weight of 822.08 g/mol. Its IUPAC name is 2,3-bis[[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]oxy]propyl 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | 2,3-bis[[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]oxy]propyl 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 19366427 |
| Molecular Formula | C48H72NO8P |
| Molecular Weight | 822.08 g/mol |
| Exact Mass | 821.50 |
| IUPAC Name | 2,3-bis[[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]oxy]propyl 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)OCC(COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)/C=C(C)/C=C/C=C(C)/C=C/C2=C(C)CCCC2(C)C)C(C)(C)CCC1 |
| InChI | InChI=1S/C48H72NO8P/c1-36(24-26-43-40(5)22-16-28-47(43,7)8)18-14-20-38(3)32-45(50)54-34-42(35-56-58(52,53)55-31-30-49(11,12)13)57-46(51)33-39(4)21-15-19-37(2)25-27-44-41(6)23-17-29-48(44,9)10/h14-15,18-21,24-27,32-33,42H,16-17,22-23,28-31,34-35H2,1-13H3/b20-14+,21-15+,26-24+,27-25+,36-18+,37-19+,38-32+,39-33+ |
| InChIKey | VUKVIDUFIUQHOY-DKFLNMIISA-N |
| XLogP | 10.71 |
| TPSA | 111.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 822.08 |
| LogP ≤ 5 | 10.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|