C19H16F6N2O2 — CID 19367016
4-[[2-[3,5-bis(trifluoromethyl)phenyl]-2-oxoethyl]amino]-3-pyridin-4-ylbutanal (PubChem CID 19367016) has the molecular formula C19H16F6N2O2 and a molecular weight of 418.34 g/mol. Its IUPAC name is 4-[[2-[3,5-bis(trifluoromethyl)phenyl]-2-oxoethyl]amino]-3-pyridin-4-ylbutanal.
| Compound Name | 4-[[2-[3,5-bis(trifluoromethyl)phenyl]-2-oxoethyl]amino]-3-pyridin-4-ylbutanal |
|---|---|
| PubChem CID | 19367016 |
| Molecular Formula | C19H16F6N2O2 |
| Molecular Weight | 418.34 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | 4-[[2-[3,5-bis(trifluoromethyl)phenyl]-2-oxoethyl]amino]-3-pyridin-4-ylbutanal |
| SMILES | O=CCC(CNCC(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1ccncc1 |
| InChI | InChI=1S/C19H16F6N2O2/c20-18(21,22)15-7-14(8-16(9-15)19(23,24)25)17(29)11-27-10-13(3-6-28)12-1-4-26-5-2-12/h1-2,4-9,13,27H,3,10-11H2 |
| InChIKey | XJFZPZZJCYJPRN-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.34 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|