C14H22ClN3 — CID 19369224
2-[2-(1-methylpyridin-1-ium-2-yl)ethyl]-3,4,5,6-tetrahydro-2H-azepin-7-amine chloride (PubChem CID 19369224) has the molecular formula C14H22ClN3 and a molecular weight of 267.80 g/mol. Its IUPAC name is 2-[2-(1-methylpyridin-1-ium-2-yl)ethyl]-3,4,5,6-tetrahydro-2H-azepin-7-amine chloride.
| Compound Name | 2-[2-(1-methylpyridin-1-ium-2-yl)ethyl]-3,4,5,6-tetrahydro-2H-azepin-7-amine chloride |
|---|---|
| PubChem CID | 19369224 |
| Molecular Formula | C14H22ClN3 |
| Molecular Weight | 267.80 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | 2-[2-(1-methylpyridin-1-ium-2-yl)ethyl]-3,4,5,6-tetrahydro-2H-azepin-7-amine chloride |
| SMILES | C[n+]1ccccc1CCC1CCCCC(N)=N1.[Cl-] |
| InChI | InChI=1S/C14H22N3.ClH/c1-17-11-5-4-7-13(17)10-9-12-6-2-3-8-14(15)16-12;/h4-5,7,11-12H,2-3,6,8-10H2,1H3,(H2,15,16);1H/q+1;/p-1 |
| InChIKey | FFTBOINEVXPXQM-UHFFFAOYSA-M |
| XLogP | -1.25 |
| TPSA | 42.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.80 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|