C21H33NO5 — CID 19369865
6,7-dimethoxy-2,4-dimethyl-2-(5-morpholin-4-ylpentyl)-3H-1-benzofuran-5-ol (PubChem CID 19369865) has the molecular formula C21H33NO5 and a molecular weight of 379.50 g/mol. Its IUPAC name is 6,7-dimethoxy-2,4-dimethyl-2-(5-morpholin-4-ylpentyl)-3H-1-benzofuran-5-ol.
| Compound Name | 6,7-dimethoxy-2,4-dimethyl-2-(5-morpholin-4-ylpentyl)-3H-1-benzofuran-5-ol |
|---|---|
| PubChem CID | 19369865 |
| Molecular Formula | C21H33NO5 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.24 |
| IUPAC Name | 6,7-dimethoxy-2,4-dimethyl-2-(5-morpholin-4-ylpentyl)-3H-1-benzofuran-5-ol |
| SMILES | COc1c(O)c(C)c2c(c1OC)OC(C)(CCCCCN1CCOCC1)C2 |
| InChI | InChI=1S/C21H33NO5/c1-15-16-14-21(2,8-6-5-7-9-22-10-12-26-13-11-22)27-18(16)20(25-4)19(24-3)17(15)23/h23H,5-14H2,1-4H3 |
| InChIKey | WTKGLWQSYSYJPF-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 60.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|