C5H9NOS — CID 19372401
2-ethyl-3H-1,2-thiazole 1-oxide (PubChem CID 19372401) has the molecular formula C5H9NOS and a molecular weight of 131.20 g/mol. Its IUPAC name is 2-ethyl-3H-1,2-thiazole 1-oxide.
| Compound Name | 2-ethyl-3H-1,2-thiazole 1-oxide |
|---|---|
| PubChem CID | 19372401 |
| Molecular Formula | C5H9NOS |
| Molecular Weight | 131.20 g/mol |
| Exact Mass | 131.04 |
| IUPAC Name | 2-ethyl-3H-1,2-thiazole 1-oxide |
| SMILES | CCN1CC=CS1=O |
| InChI | InChI=1S/C5H9NOS/c1-2-6-4-3-5-8(6)7/h3,5H,2,4H2,1H3 |
| InChIKey | HSVHURIPKHLIIG-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.20 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |