C13H18N2O2S2 — CID 19388473
methyl 4-[(2,3-dihydroxyphenyl)methyl]piperazine-1-carbodithioate (PubChem CID 19388473) has the molecular formula C13H18N2O2S2 and a molecular weight of 298.43 g/mol. Its IUPAC name is methyl 4-[(2,3-dihydroxyphenyl)methyl]piperazine-1-carbodithioate.
| Compound Name | methyl 4-[(2,3-dihydroxyphenyl)methyl]piperazine-1-carbodithioate |
|---|---|
| PubChem CID | 19388473 |
| Molecular Formula | C13H18N2O2S2 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | methyl 4-[(2,3-dihydroxyphenyl)methyl]piperazine-1-carbodithioate |
| SMILES | CSC(=S)N1CCN(Cc2cccc(O)c2O)CC1 |
| InChI | InChI=1S/C13H18N2O2S2/c1-19-13(18)15-7-5-14(6-8-15)9-10-3-2-4-11(16)12(10)17/h2-4,16-17H,5-9H2,1H3 |
| InChIKey | MRDGOWKGJYVWOJ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|