C17H24ClN3O5 — CID 19388573
6-chloro-3-[2-(diethylamino)ethyl]-1-methyl-2H-quinazolin-4-one;oxalic acid (PubChem CID 19388573) has the molecular formula C17H24ClN3O5 and a molecular weight of 385.85 g/mol. Its IUPAC name is 6-chloro-3-[2-(diethylamino)ethyl]-1-methyl-2H-quinazolin-4-one;oxalic acid.
| Compound Name | 6-chloro-3-[2-(diethylamino)ethyl]-1-methyl-2H-quinazolin-4-one;oxalic acid |
|---|---|
| PubChem CID | 19388573 |
| Molecular Formula | C17H24ClN3O5 |
| Molecular Weight | 385.85 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | 6-chloro-3-[2-(diethylamino)ethyl]-1-methyl-2H-quinazolin-4-one;oxalic acid |
| SMILES | CCN(CC)CCN1CN(C)c2ccc(Cl)cc2C1=O.O=C(O)C(=O)O |
| InChI | InChI=1S/C15H22ClN3O.C2H2O4/c1-4-18(5-2)8-9-19-11-17(3)14-7-6-12(16)10-13(14)15(19)20;3-1(4)2(5)6/h6-7,10H,4-5,8-9,11H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | AIRIRMODEVOEBQ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 101.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.85 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|