C12H16ClN2O3P — CID 10685810
7-chloro-2-ethoxy-1,4-dimethyl-2-oxo-3H-1,4,2λ5-benzodiazaphosphepin-5-one (PubChem CID 10685810) has the molecular formula C12H16ClN2O3P and a molecular weight of 302.70 g/mol. Its IUPAC name is 7-chloro-2-ethoxy-1,4-dimethyl-2-oxo-3H-1,4,2λ5-benzodiazaphosphepin-5-one.
| Compound Name | 7-chloro-2-ethoxy-1,4-dimethyl-2-oxo-3H-1,4,2λ5-benzodiazaphosphepin-5-one |
|---|---|
| PubChem CID | 10685810 |
| Molecular Formula | C12H16ClN2O3P |
| Molecular Weight | 302.70 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | 7-chloro-2-ethoxy-1,4-dimethyl-2-oxo-3H-1,4,2λ5-benzodiazaphosphepin-5-one |
| SMILES | CCOP1(=O)CN(C)C(=O)c2cc(Cl)ccc2N1C |
| InChI | InChI=1S/C12H16ClN2O3P/c1-4-18-19(17)8-14(2)12(16)10-7-9(13)5-6-11(10)15(19)3/h5-7H,4,8H2,1-3H3 |
| InChIKey | JTJJGZLMHPEHGH-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.70 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|