C24H32O10S — CID 19389744
1-(3,5-dimethoxy-2-propan-2-ylphenyl)sulfonyl-3,5-dimethoxy-2-propan-2-ylbenzene;oxalic acid (PubChem CID 19389744) has the molecular formula C24H32O10S and a molecular weight of 512.58 g/mol. Its IUPAC name is 1-(3,5-dimethoxy-2-propan-2-ylphenyl)sulfonyl-3,5-dimethoxy-2-propan-2-ylbenzene;oxalic acid.
| Compound Name | 1-(3,5-dimethoxy-2-propan-2-ylphenyl)sulfonyl-3,5-dimethoxy-2-propan-2-ylbenzene;oxalic acid |
|---|---|
| PubChem CID | 19389744 |
| Molecular Formula | C24H32O10S |
| Molecular Weight | 512.58 g/mol |
| Exact Mass | 512.17 |
| IUPAC Name | 1-(3,5-dimethoxy-2-propan-2-ylphenyl)sulfonyl-3,5-dimethoxy-2-propan-2-ylbenzene;oxalic acid |
| SMILES | COc1cc(OC)c(C(C)C)c(S(=O)(=O)c2cc(OC)cc(OC)c2C(C)C)c1.O=C(O)C(=O)O |
| InChI | InChI=1S/C22H30O6S.C2H2O4/c1-13(2)21-17(27-7)9-15(25-5)11-19(21)29(23,24)20-12-16(26-6)10-18(28-8)22(20)14(3)4;3-1(4)2(5)6/h9-14H,1-8H3;(H,3,4)(H,5,6) |
| InChIKey | BSPRNUSAERPVBM-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.58 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|