C25H30O3S — CID 19390200
2-[(1E,4E)-2-(methoxymethyl)-8,8-dimethylnona-1,4-dien-6-ynyl]-5-[[(E)-3-thiophen-3-ylprop-2-enoxy]methyl]furan (PubChem CID 19390200) has the molecular formula C25H30O3S and a molecular weight of 410.58 g/mol. Its IUPAC name is 2-[(1E,4E)-2-(methoxymethyl)-8,8-dimethylnona-1,4-dien-6-ynyl]-5-[[(E)-3-thiophen-3-ylprop-2-enoxy]methyl]furan.
| Compound Name | 2-[(1E,4E)-2-(methoxymethyl)-8,8-dimethylnona-1,4-dien-6-ynyl]-5-[[(E)-3-thiophen-3-ylprop-2-enoxy]methyl]furan |
|---|---|
| PubChem CID | 19390200 |
| Molecular Formula | C25H30O3S |
| Molecular Weight | 410.58 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | 2-[(1E,4E)-2-(methoxymethyl)-8,8-dimethylnona-1,4-dien-6-ynyl]-5-[[(E)-3-thiophen-3-ylprop-2-enoxy]methyl]furan |
| SMILES | COC/C(=C/c1ccc(COC/C=C/c2ccsc2)o1)C/C=C/C#CC(C)(C)C |
| InChI | InChI=1S/C25H30O3S/c1-25(2,3)14-7-5-6-9-22(18-26-4)17-23-11-12-24(28-23)19-27-15-8-10-21-13-16-29-20-21/h5-6,8,10-13,16-17,20H,9,15,18-19H2,1-4H3/b6-5+,10-8+,22-17+ |
| InChIKey | SUKDIKYRSCUCKP-QCEWNHSLSA-N |
| XLogP | 6.60 |
| TPSA | 31.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.58 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|