C18H18N6O5 — CID 19400609
methyl 2-[[4-[(1-ethyl-4-nitropyrazole-3-carbonyl)amino]pyrazol-1-yl]methyl]benzoate (PubChem CID 19400609) has the molecular formula C18H18N6O5 and a molecular weight of 398.38 g/mol. Its IUPAC name is methyl 2-[[4-[(1-ethyl-4-nitropyrazole-3-carbonyl)amino]pyrazol-1-yl]methyl]benzoate.
| Compound Name | methyl 2-[[4-[(1-ethyl-4-nitropyrazole-3-carbonyl)amino]pyrazol-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 19400609 |
| Molecular Formula | C18H18N6O5 |
| Molecular Weight | 398.38 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | methyl 2-[[4-[(1-ethyl-4-nitropyrazole-3-carbonyl)amino]pyrazol-1-yl]methyl]benzoate |
| SMILES | CCn1cc([N+](=O)[O-])c(C(=O)Nc2cnn(Cc3ccccc3C(=O)OC)c2)n1 |
| InChI | InChI=1S/C18H18N6O5/c1-3-22-11-15(24(27)28)16(21-22)17(25)20-13-8-19-23(10-13)9-12-6-4-5-7-14(12)18(26)29-2/h4-8,10-11H,3,9H2,1-2H3,(H,20,25) |
| InChIKey | PJXWCYFZVIMAHI-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 134.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.38 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|