C9H13NO2 — CID 19419374
3-(aminomethyl)-4,5-dimethylbenzene-1,2-diol (PubChem CID 19419374) has the molecular formula C9H13NO2 and a molecular weight of 167.21 g/mol. Its IUPAC name is 3-(aminomethyl)-4,5-dimethylbenzene-1,2-diol.
| Compound Name | 3-(aminomethyl)-4,5-dimethylbenzene-1,2-diol |
|---|---|
| PubChem CID | 19419374 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | 3-(aminomethyl)-4,5-dimethylbenzene-1,2-diol |
| SMILES | Cc1cc(O)c(O)c(CN)c1C |
| InChI | InChI=1S/C9H13NO2/c1-5-3-8(11)9(12)7(4-10)6(5)2/h3,11-12H,4,10H2,1-2H3 |
| InChIKey | XVYWHXRRFYCYFM-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|