C20H23N5O4 — CID 19419586
4-[[6-(4-carbamimidoylphenyl)-3-methoxypyridazine-4-carbonyl]amino]cyclohexane-1-carboxylic acid (PubChem CID 19419586) has the molecular formula C20H23N5O4 and a molecular weight of 397.44 g/mol. Its IUPAC name is 4-[[6-(4-carbamimidoylphenyl)-3-methoxypyridazine-4-carbonyl]amino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[[6-(4-carbamimidoylphenyl)-3-methoxypyridazine-4-carbonyl]amino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 19419586 |
| Molecular Formula | C20H23N5O4 |
| Molecular Weight | 397.44 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | 4-[[6-(4-carbamimidoylphenyl)-3-methoxypyridazine-4-carbonyl]amino]cyclohexane-1-carboxylic acid |
| SMILES | [H]/N=C(\N)c1ccc(-c2cc(C(=O)NC3CCC(C(=O)O)CC3)c(OC)nn2)cc1 |
| InChI | InChI=1S/C20H23N5O4/c1-29-19-15(18(26)23-14-8-6-13(7-9-14)20(27)28)10-16(24-25-19)11-2-4-12(5-3-11)17(21)22/h2-5,10,13-14H,6-9H2,1H3,(H3,21,22)(H,23,26)(H,27,28) |
| InChIKey | WKFWNIPBQYSEAU-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 151.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.44 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|