C22H29ClN6O3 — CID 19419768
methyl 4-[[6-(4-carbamimidoylphenyl)-3-(dimethylamino)pyridazine-4-carbonyl]amino]cyclohexane-1-carboxylate;hydrochloride (PubChem CID 19419768) has the molecular formula C22H29ClN6O3 and a molecular weight of 460.97 g/mol. Its IUPAC name is methyl 4-[[6-(4-carbamimidoylphenyl)-3-(dimethylamino)pyridazine-4-carbonyl]amino]cyclohexane-1-carboxylate;hydrochloride.
| Compound Name | methyl 4-[[6-(4-carbamimidoylphenyl)-3-(dimethylamino)pyridazine-4-carbonyl]amino]cyclohexane-1-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 19419768 |
| Molecular Formula | C22H29ClN6O3 |
| Molecular Weight | 460.97 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | methyl 4-[[6-(4-carbamimidoylphenyl)-3-(dimethylamino)pyridazine-4-carbonyl]amino]cyclohexane-1-carboxylate;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc(-c2cc(C(=O)NC3CCC(C(=O)OC)CC3)c(N(C)C)nn2)cc1 |
| InChI | InChI=1S/C22H28N6O3.ClH/c1-28(2)20-17(21(29)25-16-10-8-15(9-11-16)22(30)31-3)12-18(26-27-20)13-4-6-14(7-5-13)19(23)24;/h4-7,12,15-16H,8-11H2,1-3H3,(H3,23,24)(H,25,29);1H |
| InChIKey | OSYPEDNRQDMGEQ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 134.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.97 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|