C34H40O10 — CID 19421934
3-[[2-(2-carboxyethyl)-3-[3-[3-methoxy-4-(2-methyl-1,3-dioxolan-2-yl)-2-propylphenoxy]propoxy]phenoxy]methyl]benzoic acid (PubChem CID 19421934) has the molecular formula C34H40O10 and a molecular weight of 608.68 g/mol. Its IUPAC name is 3-[[2-(2-carboxyethyl)-3-[3-[3-methoxy-4-(2-methyl-1,3-dioxolan-2-yl)-2-propylphenoxy]propoxy]phenoxy]methyl]benzoic acid.
| Compound Name | 3-[[2-(2-carboxyethyl)-3-[3-[3-methoxy-4-(2-methyl-1,3-dioxolan-2-yl)-2-propylphenoxy]propoxy]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 19421934 |
| Molecular Formula | C34H40O10 |
| Molecular Weight | 608.68 g/mol |
| Exact Mass | 608.26 |
| IUPAC Name | 3-[[2-(2-carboxyethyl)-3-[3-[3-methoxy-4-(2-methyl-1,3-dioxolan-2-yl)-2-propylphenoxy]propoxy]phenoxy]methyl]benzoic acid |
| SMILES | CCCc1c(OCCCOc2cccc(OCc3cccc(C(=O)O)c3)c2CCC(=O)O)ccc(C2(C)OCCO2)c1OC |
| InChI | InChI=1S/C34H40O10/c1-4-8-26-30(15-14-27(32(26)39-3)34(2)43-19-20-44-34)41-18-7-17-40-28-11-6-12-29(25(28)13-16-31(35)36)42-22-23-9-5-10-24(21-23)33(37)38/h5-6,9-12,14-15,21H,4,7-8,13,16-20,22H2,1-3H3,(H,35,36)(H,37,38) |
| InChIKey | VLJKKQKWWVTKAG-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 129.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.68 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|