About 2-methylsulfanyl-N'-tritylacetohydrazide
2-methylsulfanyl-N'-tritylacetohydrazide (PubChem CID 19429994) has the molecular formula C22H22N2OS
and a molecular weight of 362.50 g/mol. Its IUPAC name is 2-methylsulfanyl-N'-tritylacetohydrazide.
Molecular Properties
| Compound Name | 2-methylsulfanyl-N'-tritylacetohydrazide |
| PubChem CID | 19429994 |
| Molecular Formula | C22H22N2OS |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | 2-methylsulfanyl-N'-tritylacetohydrazide |
| SMILES | CSCC(=O)NNC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H22N2OS/c1-26-17-21(25)23-24-22(18-11-5-2-6-12-18,19-13-7-3-8-14-19)20-15-9-4-10-16-20/h2-16,24H,17H2,1H3,(H,23,25) |
| InChIKey | OIQUYDITGXLZTM-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze 2-methylsulfanyl-N'-tritylacetohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylsulfanyl-N'-tritylacetohydrazide?
The IUPAC name of 2-methylsulfanyl-N'-tritylacetohydrazide (CID 19429994) is 2-methylsulfanyl-N'-tritylacetohydrazide.
What is the SMILES notation for 2-methylsulfanyl-N'-tritylacetohydrazide?
The canonical SMILES for 2-methylsulfanyl-N'-tritylacetohydrazide is CSCC(=O)NNC(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of 2-methylsulfanyl-N'-tritylacetohydrazide?
The InChIKey is OIQUYDITGXLZTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22N2OS/c1-26-17-21(25)23-24-22(18-11-5-2-6-12-18,19-13-7-3-8-14-19)20-15-9-4-10-16-20/h2-16,24H,17H2,1H3,(H,23,25).
What are the key properties of 2-methylsulfanyl-N'-tritylacetohydrazide?
2-methylsulfanyl-N'-tritylacetohydrazide has a molecular weight of 362.50 g/mol, XLogP of 3.96, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylsulfanyl-N'-tritylacetohydrazide is sourced from PubChem (CID 19429994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).