C15H12OS — CID 19430414
(2-phenyl-1-benzothiophen-7-yl)methanol (PubChem CID 19430414) has the molecular formula C15H12OS and a molecular weight of 240.33 g/mol. Its IUPAC name is (2-phenyl-1-benzothiophen-7-yl)methanol.
| Compound Name | (2-phenyl-1-benzothiophen-7-yl)methanol |
|---|---|
| PubChem CID | 19430414 |
| Molecular Formula | C15H12OS |
| Molecular Weight | 240.33 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | (2-phenyl-1-benzothiophen-7-yl)methanol |
| SMILES | OCc1cccc2cc(-c3ccccc3)sc12 |
| InChI | InChI=1S/C15H12OS/c16-10-13-8-4-7-12-9-14(17-15(12)13)11-5-2-1-3-6-11/h1-9,16H,10H2 |
| InChIKey | UVGFEHKQAIBFRM-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.33 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |